C32H6AlF15 — CID 141042568
(2,3,4,5,6,7,8,9,10-nonafluoropyren-1-yl)-(4,5,7-trifluoronaphthalen-1-yl)-(2,3,5-trifluorophenyl)alumane (PubChem CID 141042568) has the molecular formula C32H6AlF15 and a molecular weight of 702.35 g/mol. Its IUPAC name is (2,3,4,5,6,7,8,9,10-nonafluoropyren-1-yl)-(4,5,7-trifluoronaphthalen-1-yl)-(2,3,5-trifluorophenyl)alumane.
| Compound Name | (2,3,4,5,6,7,8,9,10-nonafluoropyren-1-yl)-(4,5,7-trifluoronaphthalen-1-yl)-(2,3,5-trifluorophenyl)alumane |
|---|---|
| PubChem CID | 141042568 |
| Molecular Formula | C32H6AlF15 |
| Molecular Weight | 702.35 g/mol |
| Exact Mass | 702.00 |
| IUPAC Name | (2,3,4,5,6,7,8,9,10-nonafluoropyren-1-yl)-(4,5,7-trifluoronaphthalen-1-yl)-(2,3,5-trifluorophenyl)alumane |
| SMILES | Fc1cc(F)c(F)c([Al](c2ccc(F)c3c(F)cc(F)cc23)c2c(F)c(F)c3c(F)c(F)c4c(F)c(F)c(F)c5c(F)c(F)c2c3c45)c1 |
| InChI | InChI=1S/C16F9.C10H4F3.C6H2F3.Al/c17-3-1-2-4-5-7(11(20)9(2)18)14(23)16(25)15(24)8(5)13(22)12(21)6(4)10(3)19;11-7-4-6-2-1-3-8(12)10(6)9(13)5-7;7-4-1-2-5(8)6(9)3-4;/h;1,3-5H;1,3H; |
| InChIKey | JADKMPIWRUVNIH-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.35 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|