C16H20F3PSi — CID 141042296
triethylsilyl-(4,5,7-trifluoronaphthalen-1-yl)phosphane (PubChem CID 141042296) has the molecular formula C16H20F3PSi and a molecular weight of 328.39 g/mol. Its IUPAC name is triethylsilyl-(4,5,7-trifluoronaphthalen-1-yl)phosphane.
| Compound Name | triethylsilyl-(4,5,7-trifluoronaphthalen-1-yl)phosphane |
|---|---|
| PubChem CID | 141042296 |
| Molecular Formula | C16H20F3PSi |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | triethylsilyl-(4,5,7-trifluoronaphthalen-1-yl)phosphane |
| SMILES | CC[Si](CC)(CC)Pc1ccc(F)c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C16H20F3PSi/c1-4-21(5-2,6-3)20-15-8-7-13(18)16-12(15)9-11(17)10-14(16)19/h7-10,20H,4-6H2,1-3H3 |
| InChIKey | UCOUDYWUGFMYSY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|