C12H13F2N — CID 142378188
6,8-difluoro-4-methylquinoline;ethane (PubChem CID 142378188) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is 6,8-difluoro-4-methylquinoline;ethane.
| Compound Name | 6,8-difluoro-4-methylquinoline;ethane |
|---|---|
| PubChem CID | 142378188 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 6,8-difluoro-4-methylquinoline;ethane |
| SMILES | CC.Cc1ccnc2c(F)cc(F)cc12 |
| InChI | InChI=1S/C10H7F2N.C2H6/c1-6-2-3-13-10-8(6)4-7(11)5-9(10)12;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | IFNBASHRDOSQSI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |