C13H18F2N2 — CID 177201340
6,8-difluoro-4-methylcinnoline;ethane (PubChem CID 177201340) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 6,8-difluoro-4-methylcinnoline;ethane.
| Compound Name | 6,8-difluoro-4-methylcinnoline;ethane |
|---|---|
| PubChem CID | 177201340 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 6,8-difluoro-4-methylcinnoline;ethane |
| SMILES | CC.CC.Cc1cnnc2c(F)cc(F)cc12 |
| InChI | InChI=1S/C9H6F2N2.2C2H6/c1-5-4-12-13-9-7(5)2-6(10)3-8(9)11;2*1-2/h2-4H,1H3;2*1-2H3 |
| InChIKey | VGNLNSZAKMTDAF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |