C9H6F2N2 — CID 177201301
5,7-difluoro-1-methylphthalazine (PubChem CID 177201301) has the molecular formula C9H6F2N2 and a molecular weight of 180.16 g/mol. Its IUPAC name is 5,7-difluoro-1-methylphthalazine.
| Compound Name | 5,7-difluoro-1-methylphthalazine |
|---|---|
| PubChem CID | 177201301 |
| Molecular Formula | C9H6F2N2 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 5,7-difluoro-1-methylphthalazine |
| SMILES | Cc1nncc2c(F)cc(F)cc12 |
| InChI | InChI=1S/C9H6F2N2/c1-5-7-2-6(10)3-9(11)8(7)4-12-13-5/h2-4H,1H3 |
| InChIKey | DSWDCCYCQTZBDL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |