About 7-bromo-4,6-difluorocinnoline
7-bromo-4,6-difluorocinnoline (PubChem CID 162682498) has the molecular formula C8H3BrF2N2
and a molecular weight of 245.03 g/mol. Its IUPAC name is 7-bromo-4,6-difluorocinnoline.
Molecular Properties
| Compound Name | 7-bromo-4,6-difluorocinnoline |
| PubChem CID | 162682498 |
| Molecular Formula | C8H3BrF2N2 |
| Molecular Weight | 245.03 g/mol |
| Exact Mass | 243.94 |
| IUPAC Name | 7-bromo-4,6-difluorocinnoline |
| SMILES | Fc1cc2c(F)cnnc2cc1Br |
| InChI | InChI=1S/C8H3BrF2N2/c9-5-2-8-4(1-6(5)10)7(11)3-12-13-8/h1-3H |
| InChIKey | SZFLOTSHXCTZNN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.03 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-4,6-difluorocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4,6-difluorocinnoline?
The IUPAC name of 7-bromo-4,6-difluorocinnoline (CID 162682498) is 7-bromo-4,6-difluorocinnoline.
What is the SMILES notation for 7-bromo-4,6-difluorocinnoline?
The canonical SMILES for 7-bromo-4,6-difluorocinnoline is Fc1cc2c(F)cnnc2cc1Br.
What is the InChIKey of 7-bromo-4,6-difluorocinnoline?
The InChIKey is SZFLOTSHXCTZNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrF2N2/c9-5-2-8-4(1-6(5)10)7(11)3-12-13-8/h1-3H.
What are the key properties of 7-bromo-4,6-difluorocinnoline?
7-bromo-4,6-difluorocinnoline has a molecular weight of 245.03 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4,6-difluorocinnoline is sourced from PubChem (CID 162682498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).