C10H9F2N3O2 — CID 172800812
carbamic acid;6,8-difluoroquinolin-4-amine (PubChem CID 172800812) has the molecular formula C10H9F2N3O2 and a molecular weight of 241.20 g/mol. Its IUPAC name is carbamic acid;6,8-difluoroquinolin-4-amine.
| Compound Name | carbamic acid;6,8-difluoroquinolin-4-amine |
|---|---|
| PubChem CID | 172800812 |
| Molecular Formula | C10H9F2N3O2 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | carbamic acid;6,8-difluoroquinolin-4-amine |
| SMILES | NC(=O)O.Nc1ccnc2c(F)cc(F)cc12 |
| InChI | InChI=1S/C9H6F2N2.CH3NO2/c10-5-3-6-8(12)1-2-13-9(6)7(11)4-5;2-1(3)4/h1-4H,(H2,12,13);2H2,(H,3,4) |
| InChIKey | QVJWKABERIIKIP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |