C13H6F2N2O2S — CID 64988724
6,8-difluoro-2-(1,3-thiazol-2-yl)quinoline-4-carboxylic acid (PubChem CID 64988724) has the molecular formula C13H6F2N2O2S and a molecular weight of 292.27 g/mol. Its IUPAC name is 6,8-difluoro-2-(1,3-thiazol-2-yl)quinoline-4-carboxylic acid.
| Compound Name | 6,8-difluoro-2-(1,3-thiazol-2-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 64988724 |
| Molecular Formula | C13H6F2N2O2S |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 6,8-difluoro-2-(1,3-thiazol-2-yl)quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2nccs2)nc2c(F)cc(F)cc12 |
| InChI | InChI=1S/C13H6F2N2O2S/c14-6-3-7-8(13(18)19)5-10(12-16-1-2-20-12)17-11(7)9(15)4-6/h1-5H,(H,18,19) |
| InChIKey | GBXHVHDLRZWGHN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |