C16H10F2N2O2 — CID 46397774
3-[(6,8-difluoroquinolin-4-yl)amino]benzoic acid (PubChem CID 46397774) has the molecular formula C16H10F2N2O2 and a molecular weight of 300.26 g/mol. Its IUPAC name is 3-[(6,8-difluoroquinolin-4-yl)amino]benzoic acid.
| Compound Name | 3-[(6,8-difluoroquinolin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 46397774 |
| Molecular Formula | C16H10F2N2O2 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 3-[(6,8-difluoroquinolin-4-yl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2ccnc3c(F)cc(F)cc23)c1 |
| InChI | InChI=1S/C16H10F2N2O2/c17-10-7-12-14(4-5-19-15(12)13(18)8-10)20-11-3-1-2-9(6-11)16(21)22/h1-8H,(H,19,20)(H,21,22) |
| InChIKey | HIAUWWHAVSUINZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |