C17H12F2N2O2 — CID 23239670
6,8-difluoro-4-(3-methylanilino)quinoline-3-carboxylic acid (PubChem CID 23239670) has the molecular formula C17H12F2N2O2 and a molecular weight of 314.29 g/mol. Its IUPAC name is 6,8-difluoro-4-(3-methylanilino)quinoline-3-carboxylic acid.
| Compound Name | 6,8-difluoro-4-(3-methylanilino)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23239670 |
| Molecular Formula | C17H12F2N2O2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 6,8-difluoro-4-(3-methylanilino)quinoline-3-carboxylic acid |
| SMILES | Cc1cccc(Nc2c(C(=O)O)cnc3c(F)cc(F)cc23)c1 |
| InChI | InChI=1S/C17H12F2N2O2/c1-9-3-2-4-11(5-9)21-15-12-6-10(18)7-14(19)16(12)20-8-13(15)17(22)23/h2-8H,1H3,(H,20,21)(H,22,23) |
| InChIKey | SCCZGDFJGOHRQV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |