C28H20BF8Na — CID 139958515
sodium tetrakis(3,5-difluoro-2-methylphenyl)boranuide (PubChem CID 139958515) has the molecular formula C28H20BF8Na and a molecular weight of 542.25 g/mol. Its IUPAC name is sodium tetrakis(3,5-difluoro-2-methylphenyl)boranuide.
| Compound Name | sodium tetrakis(3,5-difluoro-2-methylphenyl)boranuide |
|---|---|
| PubChem CID | 139958515 |
| Molecular Formula | C28H20BF8Na |
| Molecular Weight | 542.25 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | sodium tetrakis(3,5-difluoro-2-methylphenyl)boranuide |
| SMILES | Cc1c(F)cc(F)cc1[B-](c1cc(F)cc(F)c1C)(c1cc(F)cc(F)c1C)c1cc(F)cc(F)c1C.[Na+] |
| InChI | InChI=1S/C28H20BF8.Na/c1-13-21(5-17(30)9-25(13)34)29(22-6-18(31)10-26(35)14(22)2,23-7-19(32)11-27(36)15(23)3)24-8-20(33)12-28(37)16(24)4;/h5-12H,1-4H3;/q-1;+1 |
| InChIKey | WWAQOVAXVBBYMW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|