C40H46BF8N — CID 87935581
cyclohexyl-di(propan-2-yl)azanium;tetrakis(3,5-difluoro-2-methylphenyl)boranuide (PubChem CID 87935581) has the molecular formula C40H46BF8N and a molecular weight of 703.61 g/mol. Its IUPAC name is cyclohexyl-di(propan-2-yl)azanium;tetrakis(3,5-difluoro-2-methylphenyl)boranuide.
| Compound Name | cyclohexyl-di(propan-2-yl)azanium;tetrakis(3,5-difluoro-2-methylphenyl)boranuide |
|---|---|
| PubChem CID | 87935581 |
| Molecular Formula | C40H46BF8N |
| Molecular Weight | 703.61 g/mol |
| Exact Mass | 703.36 |
| IUPAC Name | cyclohexyl-di(propan-2-yl)azanium;tetrakis(3,5-difluoro-2-methylphenyl)boranuide |
| SMILES | CC(C)[NH+](C(C)C)C1CCCCC1.Cc1c(F)cc(F)cc1[B-](c1cc(F)cc(F)c1C)(c1cc(F)cc(F)c1C)c1cc(F)cc(F)c1C |
| InChI | InChI=1S/C28H20BF8.C12H25N/c1-13-21(5-17(30)9-25(13)34)29(22-6-18(31)10-26(35)14(22)2,23-7-19(32)11-27(36)15(23)3)24-8-20(33)12-28(37)16(24)4;1-10(2)13(11(3)4)12-8-6-5-7-9-12/h5-12H,1-4H3;10-12H,5-9H2,1-4H3/q-1;/p+1 |
| InChIKey | FMFKIOZNDFDLSY-UHFFFAOYSA-O |
| XLogP | 7.43 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.61 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|