C9H14BNO5 — CID 174501310
[4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid (PubChem CID 174501310) has the molecular formula C9H14BNO5 and a molecular weight of 227.03 g/mol. Its IUPAC name is [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid.
| Compound Name | [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid |
|---|---|
| PubChem CID | 174501310 |
| Molecular Formula | C9H14BNO5 |
| Molecular Weight | 227.03 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid |
| SMILES | COc1cc(OB(O)O)cc(OC)c1CN |
| InChI | InChI=1S/C9H14BNO5/c1-14-8-3-6(16-10(12)13)4-9(15-2)7(8)5-11/h3-4,12-13H,5,11H2,1-2H3 |
| InChIKey | QDYANFUGWZKIGT-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.03 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|