[4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid

C9H14BNO5 — CID 174501310

IUPAC[4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid
SMILESCOc1cc(OB(O)O)cc(OC)c1CN
InChIInChI=1S/C9H14BNO5/c1-14-8-3-6(16-10(12)13)4-9(15-2)7(8)5-11/h3-4,12-13H,5,11H2,1-2H3
InChIKeyQDYANFUGWZKIGT-UHFFFAOYSA-N
MW227.03 g/mol
LogP-0.49
Rot. Bonds5

About [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid

[4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid (PubChem CID 174501310) has the molecular formula C9H14BNO5 and a molecular weight of 227.03 g/mol. Its IUPAC name is [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid.

Molecular Properties

Compound Name[4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid
PubChem CID174501310
Molecular FormulaC9H14BNO5
Molecular Weight227.03 g/mol
Exact Mass227.10
IUPAC Name[4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid
SMILESCOc1cc(OB(O)O)cc(OC)c1CN
InChIInChI=1S/C9H14BNO5/c1-14-8-3-6(16-10(12)13)4-9(15-2)7(8)5-11/h3-4,12-13H,5,11H2,1-2H3
InChIKeyQDYANFUGWZKIGT-UHFFFAOYSA-N
XLogP-0.49
TPSA94.17 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.03
LogP ≤ 5-0.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid?
The IUPAC name of [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid (CID 174501310) is [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid.
What is the SMILES notation for [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid?
The canonical SMILES for [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid is COc1cc(OB(O)O)cc(OC)c1CN.
What is the InChIKey of [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid?
The InChIKey is QDYANFUGWZKIGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BNO5/c1-14-8-3-6(16-10(12)13)4-9(15-2)7(8)5-11/h3-4,12-13H,5,11H2,1-2H3.
What are the key properties of [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid?
[4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid has a molecular weight of 227.03 g/mol, XLogP of -0.49, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)-3,5-dimethoxyphenoxy]boronic acid is sourced from PubChem (CID 174501310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).