C11H17BO4 — CID 54089245
(2,3-diethyl-4-methoxyphenoxy)boronic acid (PubChem CID 54089245) has the molecular formula C11H17BO4 and a molecular weight of 224.06 g/mol. Its IUPAC name is (2,3-diethyl-4-methoxyphenoxy)boronic acid.
| Compound Name | (2,3-diethyl-4-methoxyphenoxy)boronic acid |
|---|---|
| PubChem CID | 54089245 |
| Molecular Formula | C11H17BO4 |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (2,3-diethyl-4-methoxyphenoxy)boronic acid |
| SMILES | CCc1c(OC)ccc(OB(O)O)c1CC |
| InChI | InChI=1S/C11H17BO4/c1-4-8-9(5-2)11(16-12(13)14)7-6-10(8)15-3/h6-7,13-14H,4-5H2,1-3H3 |
| InChIKey | MSRNIBMKYXISDH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|