C10H13BrO2 — CID 84704847
2-bromo-3-ethyl-1,4-dimethoxybenzene (PubChem CID 84704847) has the molecular formula C10H13BrO2 and a molecular weight of 245.12 g/mol. Its IUPAC name is 2-bromo-3-ethyl-1,4-dimethoxybenzene.
| Compound Name | 2-bromo-3-ethyl-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 84704847 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 2-bromo-3-ethyl-1,4-dimethoxybenzene |
| SMILES | CCc1c(OC)ccc(OC)c1Br |
| InChI | InChI=1S/C10H13BrO2/c1-4-7-8(12-2)5-6-9(13-3)10(7)11/h5-6H,4H2,1-3H3 |
| InChIKey | FOQYERFNPRYIJA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |