C9H9Br3O — CID 11740051
1-bromo-2,3-bis(bromomethyl)-4-methoxybenzene (PubChem CID 11740051) has the molecular formula C9H9Br3O and a molecular weight of 372.88 g/mol. Its IUPAC name is 1-bromo-2,3-bis(bromomethyl)-4-methoxybenzene.
| Compound Name | 1-bromo-2,3-bis(bromomethyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 11740051 |
| Molecular Formula | C9H9Br3O |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 369.82 |
| IUPAC Name | 1-bromo-2,3-bis(bromomethyl)-4-methoxybenzene |
| SMILES | COc1ccc(Br)c(CBr)c1CBr |
| InChI | InChI=1S/C9H9Br3O/c1-13-9-3-2-8(12)6(4-10)7(9)5-11/h2-3H,4-5H2,1H3 |
| InChIKey | VIXWACSKLULTOE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|