C10H13BrO3 — CID 10989047
1-bromo-2,4-dimethoxy-3-(methoxymethyl)benzene (PubChem CID 10989047) has the molecular formula C10H13BrO3 and a molecular weight of 261.11 g/mol. Its IUPAC name is 1-bromo-2,4-dimethoxy-3-(methoxymethyl)benzene.
| Compound Name | 1-bromo-2,4-dimethoxy-3-(methoxymethyl)benzene |
|---|---|
| PubChem CID | 10989047 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 1-bromo-2,4-dimethoxy-3-(methoxymethyl)benzene |
| SMILES | COCc1c(OC)ccc(Br)c1OC |
| InChI | InChI=1S/C10H13BrO3/c1-12-6-7-9(13-2)5-4-8(11)10(7)14-3/h4-5H,6H2,1-3H3 |
| InChIKey | KYTGISJOVDCTMG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |