C11H13BrO2 — CID 51033165
1-bromo-2,4-dimethoxy-3-prop-2-enylbenzene (PubChem CID 51033165) has the molecular formula C11H13BrO2 and a molecular weight of 257.13 g/mol. Its IUPAC name is 1-bromo-2,4-dimethoxy-3-prop-2-enylbenzene.
| Compound Name | 1-bromo-2,4-dimethoxy-3-prop-2-enylbenzene |
|---|---|
| PubChem CID | 51033165 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 1-bromo-2,4-dimethoxy-3-prop-2-enylbenzene |
| SMILES | C=CCc1c(OC)ccc(Br)c1OC |
| InChI | InChI=1S/C11H13BrO2/c1-4-5-8-10(13-2)7-6-9(12)11(8)14-3/h4,6-7H,1,5H2,2-3H3 |
| InChIKey | COBQAYMXUQCJSX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|