C11H13FO2 — CID 13487722
3-fluoro-1,2-dimethoxy-4-prop-2-enylbenzene (PubChem CID 13487722) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is 3-fluoro-1,2-dimethoxy-4-prop-2-enylbenzene.
| Compound Name | 3-fluoro-1,2-dimethoxy-4-prop-2-enylbenzene |
|---|---|
| PubChem CID | 13487722 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 3-fluoro-1,2-dimethoxy-4-prop-2-enylbenzene |
| SMILES | C=CCc1ccc(OC)c(OC)c1F |
| InChI | InChI=1S/C11H13FO2/c1-4-5-8-6-7-9(13-2)11(14-3)10(8)12/h4,6-7H,1,5H2,2-3H3 |
| InChIKey | QZMDHDPMYDFKCA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|