C8H9FO2S — CID 130971498
2-fluoro-3,4-dimethoxybenzenethiol (PubChem CID 130971498) has the molecular formula C8H9FO2S and a molecular weight of 188.22 g/mol. Its IUPAC name is 2-fluoro-3,4-dimethoxybenzenethiol.
| Compound Name | 2-fluoro-3,4-dimethoxybenzenethiol |
|---|---|
| PubChem CID | 130971498 |
| Molecular Formula | C8H9FO2S |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 2-fluoro-3,4-dimethoxybenzenethiol |
| SMILES | COc1ccc(S)c(F)c1OC |
| InChI | InChI=1S/C8H9FO2S/c1-10-5-3-4-6(12)7(9)8(5)11-2/h3-4,12H,1-2H3 |
| InChIKey | NROQYKWXVYBUTC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|