C13H17FO4 — CID 58147667
methyl 4-(2-fluoro-3,4-dimethoxyphenyl)butanoate (PubChem CID 58147667) has the molecular formula C13H17FO4 and a molecular weight of 256.27 g/mol. Its IUPAC name is methyl 4-(2-fluoro-3,4-dimethoxyphenyl)butanoate.
| Compound Name | methyl 4-(2-fluoro-3,4-dimethoxyphenyl)butanoate |
|---|---|
| PubChem CID | 58147667 |
| Molecular Formula | C13H17FO4 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | methyl 4-(2-fluoro-3,4-dimethoxyphenyl)butanoate |
| SMILES | COC(=O)CCCc1ccc(OC)c(OC)c1F |
| InChI | InChI=1S/C13H17FO4/c1-16-10-8-7-9(12(14)13(10)18-3)5-4-6-11(15)17-2/h7-8H,4-6H2,1-3H3 |
| InChIKey | OKUBXEHHWFYUCS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |