C12H19BO3 — CID 68718555
(2,3,4-triethylphenoxy)boronic acid (PubChem CID 68718555) has the molecular formula C12H19BO3 and a molecular weight of 222.09 g/mol. Its IUPAC name is (2,3,4-triethylphenoxy)boronic acid.
| Compound Name | (2,3,4-triethylphenoxy)boronic acid |
|---|---|
| PubChem CID | 68718555 |
| Molecular Formula | C12H19BO3 |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (2,3,4-triethylphenoxy)boronic acid |
| SMILES | CCc1ccc(OB(O)O)c(CC)c1CC |
| InChI | InChI=1S/C12H19BO3/c1-4-9-7-8-12(16-13(14)15)11(6-3)10(9)5-2/h7-8,14-15H,4-6H2,1-3H3 |
| InChIKey | IUOJNOHCXOJVAV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|