C18H22O2 — CID 67179533
2-(2,3,4-triethylphenoxy)phenol (PubChem CID 67179533) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-(2,3,4-triethylphenoxy)phenol.
| Compound Name | 2-(2,3,4-triethylphenoxy)phenol |
|---|---|
| PubChem CID | 67179533 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-(2,3,4-triethylphenoxy)phenol |
| SMILES | CCc1ccc(Oc2ccccc2O)c(CC)c1CC |
| InChI | InChI=1S/C18H22O2/c1-4-13-11-12-17(15(6-3)14(13)5-2)20-18-10-8-7-9-16(18)19/h7-12,19H,4-6H2,1-3H3 |
| InChIKey | WIZSKRCQEMKYBQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |