C14H14O3 — CID 23109139
2-(2-ethylphenoxy)benzene-1,3-diol (PubChem CID 23109139) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-(2-ethylphenoxy)benzene-1,3-diol.
| Compound Name | 2-(2-ethylphenoxy)benzene-1,3-diol |
|---|---|
| PubChem CID | 23109139 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-(2-ethylphenoxy)benzene-1,3-diol |
| SMILES | CCc1ccccc1Oc1c(O)cccc1O |
| InChI | InChI=1S/C14H14O3/c1-2-10-6-3-4-9-13(10)17-14-11(15)7-5-8-12(14)16/h3-9,15-16H,2H2,1H3 |
| InChIKey | LHBIBHAQCMTHCM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |