C11H14BrFO2 — CID 59135186
1-bromo-3-fluoro-4,5-dimethoxy-2-propan-2-ylbenzene (PubChem CID 59135186) has the molecular formula C11H14BrFO2 and a molecular weight of 277.13 g/mol. Its IUPAC name is 1-bromo-3-fluoro-4,5-dimethoxy-2-propan-2-ylbenzene.
| Compound Name | 1-bromo-3-fluoro-4,5-dimethoxy-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 59135186 |
| Molecular Formula | C11H14BrFO2 |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 1-bromo-3-fluoro-4,5-dimethoxy-2-propan-2-ylbenzene |
| SMILES | COc1cc(Br)c(C(C)C)c(F)c1OC |
| InChI | InChI=1S/C11H14BrFO2/c1-6(2)9-7(12)5-8(14-3)11(15-4)10(9)13/h5-6H,1-4H3 |
| InChIKey | CGAGUPNDBVJZCW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |