C11H12O5S — CID 117393851
2-(3,4-dimethoxy-2-methylsulfanylphenyl)-2-oxoacetic acid (PubChem CID 117393851) has the molecular formula C11H12O5S and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-2-methylsulfanylphenyl)-2-oxoacetic acid.
| Compound Name | 2-(3,4-dimethoxy-2-methylsulfanylphenyl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 117393851 |
| Molecular Formula | C11H12O5S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-(3,4-dimethoxy-2-methylsulfanylphenyl)-2-oxoacetic acid |
| SMILES | COc1ccc(C(=O)C(=O)O)c(SC)c1OC |
| InChI | InChI=1S/C11H12O5S/c1-15-7-5-4-6(8(12)11(13)14)10(17-3)9(7)16-2/h4-5H,1-3H3,(H,13,14) |
| InChIKey | WUOJZCUKHOMONS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|