C9H9F2IO2 — CID 119023099
2-(difluoromethyl)-1-iodo-3,4-dimethoxybenzene (PubChem CID 119023099) has the molecular formula C9H9F2IO2 and a molecular weight of 314.07 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-iodo-3,4-dimethoxybenzene.
| Compound Name | 2-(difluoromethyl)-1-iodo-3,4-dimethoxybenzene |
|---|---|
| PubChem CID | 119023099 |
| Molecular Formula | C9H9F2IO2 |
| Molecular Weight | 314.07 g/mol |
| Exact Mass | 313.96 |
| IUPAC Name | 2-(difluoromethyl)-1-iodo-3,4-dimethoxybenzene |
| SMILES | COc1ccc(I)c(C(F)F)c1OC |
| InChI | InChI=1S/C9H9F2IO2/c1-13-6-4-3-5(12)7(9(10)11)8(6)14-2/h3-4,9H,1-2H3 |
| InChIKey | CNHVFMNNDBJBGX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.07 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|