C12H17ClO2 — CID 89002791
3-(1-chloropropyl)-1,2-dimethoxy-4-methylbenzene (PubChem CID 89002791) has the molecular formula C12H17ClO2 and a molecular weight of 228.72 g/mol. Its IUPAC name is 3-(1-chloropropyl)-1,2-dimethoxy-4-methylbenzene.
| Compound Name | 3-(1-chloropropyl)-1,2-dimethoxy-4-methylbenzene |
|---|---|
| PubChem CID | 89002791 |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-(1-chloropropyl)-1,2-dimethoxy-4-methylbenzene |
| SMILES | CCC(Cl)c1c(C)ccc(OC)c1OC |
| InChI | InChI=1S/C12H17ClO2/c1-5-9(13)11-8(2)6-7-10(14-3)12(11)15-4/h6-7,9H,5H2,1-4H3 |
| InChIKey | PBIBDPMGFDEEIT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|