C12H18INO2 — CID 10640506
2-(2-iodo-3,4-dimethoxyphenyl)-N,N-dimethylethanamine (PubChem CID 10640506) has the molecular formula C12H18INO2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 2-(2-iodo-3,4-dimethoxyphenyl)-N,N-dimethylethanamine.
| Compound Name | 2-(2-iodo-3,4-dimethoxyphenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 10640506 |
| Molecular Formula | C12H18INO2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-(2-iodo-3,4-dimethoxyphenyl)-N,N-dimethylethanamine |
| SMILES | COc1ccc(CCN(C)C)c(I)c1OC |
| InChI | InChI=1S/C12H18INO2/c1-14(2)8-7-9-5-6-10(15-3)12(16-4)11(9)13/h5-6H,7-8H2,1-4H3 |
| InChIKey | UKOGLJBOOBVPGU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|