C13H18N2O2 — CID 117043515
2-(2,4-dimethoxy-3-methylphenyl)ethyl-methylcyanamide (PubChem CID 117043515) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-3-methylphenyl)ethyl-methylcyanamide.
| Compound Name | 2-(2,4-dimethoxy-3-methylphenyl)ethyl-methylcyanamide |
|---|---|
| PubChem CID | 117043515 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-(2,4-dimethoxy-3-methylphenyl)ethyl-methylcyanamide |
| SMILES | COc1ccc(CCN(C)C#N)c(OC)c1C |
| InChI | InChI=1S/C13H18N2O2/c1-10-12(16-3)6-5-11(13(10)17-4)7-8-15(2)9-14/h5-6H,7-8H2,1-4H3 |
| InChIKey | MXWRYHQKVYWTQR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|