C12H18N2O4 — CID 46930718
N-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]nitrous amide (PubChem CID 46930718) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is N-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]nitrous amide.
| Compound Name | N-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]nitrous amide |
|---|---|
| PubChem CID | 46930718 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N-methyl-N-[2-(2,3,4-trimethoxyphenyl)ethyl]nitrous amide |
| SMILES | COc1ccc(CCN(C)N=O)c(OC)c1OC |
| InChI | InChI=1S/C12H18N2O4/c1-14(13-15)8-7-9-5-6-10(16-2)12(18-4)11(9)17-3/h5-6H,7-8H2,1-4H3 |
| InChIKey | AORGNAYPNGWHJR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|