C9H8INaO4 — CID 24721325
sodium 6-iodo-2,3-dimethoxybenzoate (PubChem CID 24721325) has the molecular formula C9H8INaO4 and a molecular weight of 330.05 g/mol. Its IUPAC name is sodium 6-iodo-2,3-dimethoxybenzoate.
| Compound Name | sodium 6-iodo-2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 24721325 |
| Molecular Formula | C9H8INaO4 |
| Molecular Weight | 330.05 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | sodium 6-iodo-2,3-dimethoxybenzoate |
| SMILES | COc1ccc(I)c(C(=O)[O-])c1OC.[Na+] |
| InChI | InChI=1S/C9H9IO4.Na/c1-13-6-4-3-5(10)7(9(11)12)8(6)14-2;/h3-4H,1-2H3,(H,11,12);/q;+1/p-1 |
| InChIKey | OGELCGRDKBSKSS-UHFFFAOYSA-M |
| XLogP | -2.32 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.05 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|