C14H22LiO4P — CID 174400572
lithium;hydride;2-methylpropylphosphanyl-(2,3,6-trimethoxyphenyl)methanone (PubChem CID 174400572) has the molecular formula C14H22LiO4P and a molecular weight of 292.24 g/mol. Its IUPAC name is lithium;hydride;2-methylpropylphosphanyl-(2,3,6-trimethoxyphenyl)methanone.
| Compound Name | lithium;hydride;2-methylpropylphosphanyl-(2,3,6-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 174400572 |
| Molecular Formula | C14H22LiO4P |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | lithium;hydride;2-methylpropylphosphanyl-(2,3,6-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(OC)c(C(=O)PCC(C)C)c1OC.[H-].[Li+] |
| InChI | InChI=1S/C14H21O4P.Li.H/c1-9(2)8-19-14(15)12-10(16-3)6-7-11(17-4)13(12)18-5;;/h6-7,9,19H,8H2,1-5H3;;/q;+1;-1 |
| InChIKey | YBIRZLKGXVEKKF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|