C13H20LiO3P — CID 174399349
lithium;(2,6-dimethoxyphenyl)-(2-methylpropylphosphanyl)methanone;hydride (PubChem CID 174399349) has the molecular formula C13H20LiO3P and a molecular weight of 262.21 g/mol. Its IUPAC name is lithium;(2,6-dimethoxyphenyl)-(2-methylpropylphosphanyl)methanone;hydride.
| Compound Name | lithium;(2,6-dimethoxyphenyl)-(2-methylpropylphosphanyl)methanone;hydride |
|---|---|
| PubChem CID | 174399349 |
| Molecular Formula | C13H20LiO3P |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | lithium;(2,6-dimethoxyphenyl)-(2-methylpropylphosphanyl)methanone;hydride |
| SMILES | COc1cccc(OC)c1C(=O)PCC(C)C.[H-].[Li+] |
| InChI | InChI=1S/C13H19O3P.Li.H/c1-9(2)8-17-13(14)12-10(15-3)6-5-7-11(12)16-4;;/h5-7,9,17H,8H2,1-4H3;;/q;+1;-1 |
| InChIKey | MMHWQDRFICKNRF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|