C11H13F2IO — CID 20632201
2,3-difluoro-1-iodo-4-pentoxybenzene (PubChem CID 20632201) has the molecular formula C11H13F2IO and a molecular weight of 326.12 g/mol. Its IUPAC name is 2,3-difluoro-1-iodo-4-pentoxybenzene.
| Compound Name | 2,3-difluoro-1-iodo-4-pentoxybenzene |
|---|---|
| PubChem CID | 20632201 |
| Molecular Formula | C11H13F2IO |
| Molecular Weight | 326.12 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 2,3-difluoro-1-iodo-4-pentoxybenzene |
| SMILES | CCCCCOc1ccc(I)c(F)c1F |
| InChI | InChI=1S/C11H13F2IO/c1-2-3-4-7-15-9-6-5-8(14)10(12)11(9)13/h5-6H,2-4,7H2,1H3 |
| InChIKey | SOHMZTDXHNIKQQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.12 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|