C9H13N5O4S — CID 168605804
2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-methoxybenzenesulfonic acid (PubChem CID 168605804) has the molecular formula C9H13N5O4S and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-methoxybenzenesulfonic acid.
| Compound Name | 2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 168605804 |
| Molecular Formula | C9H13N5O4S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(/N=C(\N)N=C(N)N)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C9H13N5O4S/c1-18-5-2-3-6(7(4-5)19(15,16)17)13-9(12)14-8(10)11/h2-4H,1H3,(H,15,16,17)(H6,10,11,12,13,14) |
| InChIKey | ZEYBZBDIFPRCGK-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 166.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|