C10H13N3O — CID 89470377
2-(4-methoxy-2-methylphenyl)-1-methylideneguanidine (PubChem CID 89470377) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(4-methoxy-2-methylphenyl)-1-methylideneguanidine.
| Compound Name | 2-(4-methoxy-2-methylphenyl)-1-methylideneguanidine |
|---|---|
| PubChem CID | 89470377 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-(4-methoxy-2-methylphenyl)-1-methylideneguanidine |
| SMILES | C=N/C(N)=N\c1ccc(OC)cc1C |
| InChI | InChI=1S/C10H13N3O/c1-7-6-8(14-3)4-5-9(7)13-10(11)12-2/h4-6H,2H2,1,3H3,(H2,11,13) |
| InChIKey | DSHFQMBAHFJEHQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|