C10H9ClF3NO — CID 14972216
2,2,2-trifluoro-N-(4-methoxy-2-methylphenyl)ethanimidoyl chloride (PubChem CID 14972216) has the molecular formula C10H9ClF3NO and a molecular weight of 251.64 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-methoxy-2-methylphenyl)ethanimidoyl chloride.
| Compound Name | 2,2,2-trifluoro-N-(4-methoxy-2-methylphenyl)ethanimidoyl chloride |
|---|---|
| PubChem CID | 14972216 |
| Molecular Formula | C10H9ClF3NO |
| Molecular Weight | 251.64 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-methoxy-2-methylphenyl)ethanimidoyl chloride |
| SMILES | COc1ccc(/N=C(\Cl)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C10H9ClF3NO/c1-6-5-7(16-2)3-4-8(6)15-9(11)10(12,13)14/h3-5H,1-2H3/b15-9- |
| InChIKey | QUORHBGHQVSNMA-DHDCSXOGSA-N |
| XLogP | 3.83 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|