C8H4ClF3IN — CID 23131652
2,2,2-trifluoro-N-(2-iodophenyl)ethanimidoyl chloride (PubChem CID 23131652) has the molecular formula C8H4ClF3IN and a molecular weight of 333.48 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-iodophenyl)ethanimidoyl chloride.
| Compound Name | 2,2,2-trifluoro-N-(2-iodophenyl)ethanimidoyl chloride |
|---|---|
| PubChem CID | 23131652 |
| Molecular Formula | C8H4ClF3IN |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-iodophenyl)ethanimidoyl chloride |
| SMILES | FC(F)(F)/C(Cl)=N/c1ccccc1I |
| InChI | InChI=1S/C8H4ClF3IN/c9-7(8(10,11)12)14-6-4-2-1-3-5(6)13/h1-4H/b14-7- |
| InChIKey | MWUIPXRSLWLIFP-AUWJEWJLSA-N |
| XLogP | 4.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|