C10H9ClF3NO2 — CID 139228942
2,2,2-trifluoro-N-[2-(hydroxymethyl)-4-methoxyphenyl]ethanimidoyl chloride (PubChem CID 139228942) has the molecular formula C10H9ClF3NO2 and a molecular weight of 267.63 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(hydroxymethyl)-4-methoxyphenyl]ethanimidoyl chloride.
| Compound Name | 2,2,2-trifluoro-N-[2-(hydroxymethyl)-4-methoxyphenyl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 139228942 |
| Molecular Formula | C10H9ClF3NO2 |
| Molecular Weight | 267.63 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(hydroxymethyl)-4-methoxyphenyl]ethanimidoyl chloride |
| SMILES | COc1ccc(/N=C(\Cl)C(F)(F)F)c(CO)c1 |
| InChI | InChI=1S/C10H9ClF3NO2/c1-17-7-2-3-8(6(4-7)5-16)15-9(11)10(12,13)14/h2-4,16H,5H2,1H3/b15-9- |
| InChIKey | XTSWGQPPIVOCKC-DHDCSXOGSA-N |
| XLogP | 3.02 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|