C14H12F2N2O3 — CID 153368055
3,5-difluoro-4-[[2-(hydroxymethyl)-4-methoxyphenyl]diazenyl]phenol (PubChem CID 153368055) has the molecular formula C14H12F2N2O3 and a molecular weight of 294.26 g/mol. Its IUPAC name is 3,5-difluoro-4-[[2-(hydroxymethyl)-4-methoxyphenyl]diazenyl]phenol.
| Compound Name | 3,5-difluoro-4-[[2-(hydroxymethyl)-4-methoxyphenyl]diazenyl]phenol |
|---|---|
| PubChem CID | 153368055 |
| Molecular Formula | C14H12F2N2O3 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3,5-difluoro-4-[[2-(hydroxymethyl)-4-methoxyphenyl]diazenyl]phenol |
| SMILES | COc1ccc(/N=N/c2c(F)cc(O)cc2F)c(CO)c1 |
| InChI | InChI=1S/C14H12F2N2O3/c1-21-10-2-3-13(8(4-10)7-19)17-18-14-11(15)5-9(20)6-12(14)16/h2-6,19-20H,7H2,1H3/b18-17+ |
| InChIKey | CILABOCCOSHQDL-ISLYRVAYSA-N |
| XLogP | 3.59 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|