C11H14F3NO3 — CID 163835192
1-amino-2,2,2-trifluoro-1-[2-(2-hydroxyethyl)-4-methoxyphenyl]ethanol (PubChem CID 163835192) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is 1-amino-2,2,2-trifluoro-1-[2-(2-hydroxyethyl)-4-methoxyphenyl]ethanol.
| Compound Name | 1-amino-2,2,2-trifluoro-1-[2-(2-hydroxyethyl)-4-methoxyphenyl]ethanol |
|---|---|
| PubChem CID | 163835192 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-amino-2,2,2-trifluoro-1-[2-(2-hydroxyethyl)-4-methoxyphenyl]ethanol |
| SMILES | COc1ccc(C(N)(O)C(F)(F)F)c(CCO)c1 |
| InChI | InChI=1S/C11H14F3NO3/c1-18-8-2-3-9(7(6-8)4-5-16)10(15,17)11(12,13)14/h2-3,6,16-17H,4-5,15H2,1H3 |
| InChIKey | OHDDCSWRJPDDPA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|