C15H17N5O2 — CID 168602521
1-(diaminomethylidene)-2-[2-(4-methoxyphenoxy)phenyl]guanidine (PubChem CID 168602521) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(4-methoxyphenoxy)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(4-methoxyphenoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 168602521 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(4-methoxyphenoxy)phenyl]guanidine |
| SMILES | COc1ccc(Oc2ccccc2/N=C(\N)N=C(N)N)cc1 |
| InChI | InChI=1S/C15H17N5O2/c1-21-10-6-8-11(9-7-10)22-13-5-3-2-4-12(13)19-15(18)20-14(16)17/h2-9H,1H3,(H6,16,17,18,19,20) |
| InChIKey | GZBMEOCXWUILNH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|