C22H30N10O2 — CID 134147776
1-N',4-N'-bis[N'-(2-methoxyphenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide (PubChem CID 134147776) has the molecular formula C22H30N10O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is 1-N',4-N'-bis[N'-(2-methoxyphenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide.
| Compound Name | 1-N',4-N'-bis[N'-(2-methoxyphenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide |
|---|---|
| PubChem CID | 134147776 |
| Molecular Formula | C22H30N10O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 1-N',4-N'-bis[N'-(2-methoxyphenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide |
| SMILES | COc1ccccc1/N=C(N)/N=C(\N)N1CCN(/C(N)=N/C(N)=N/c2ccccc2OC)CC1 |
| InChI | InChI=1S/C22H30N10O2/c1-33-17-9-5-3-7-15(17)27-19(23)29-21(25)31-11-13-32(14-12-31)22(26)30-20(24)28-16-8-4-6-10-18(16)34-2/h3-10H,11-14H2,1-2H3,(H4,23,25,27,29)(H4,24,26,28,30) |
| InChIKey | BOXGPKAGNWVHRS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 178.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|