C28H42N10 — CID 134140456
1-N',4-N'-bis[N'-(4-tert-butylphenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide (PubChem CID 134140456) has the molecular formula C28H42N10 and a molecular weight of 518.71 g/mol. Its IUPAC name is 1-N',4-N'-bis[N'-(4-tert-butylphenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide.
| Compound Name | 1-N',4-N'-bis[N'-(4-tert-butylphenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide |
|---|---|
| PubChem CID | 134140456 |
| Molecular Formula | C28H42N10 |
| Molecular Weight | 518.71 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | 1-N',4-N'-bis[N'-(4-tert-butylphenyl)carbamimidoyl]piperazine-1,4-dicarboximidamide |
| SMILES | CC(C)(C)c1ccc(/N=C(N)/N=C(\N)N2CCN(/C(N)=N/C(N)=N/c3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H42N10/c1-27(2,3)19-7-11-21(12-8-19)33-23(29)35-25(31)37-15-17-38(18-16-37)26(32)36-24(30)34-22-13-9-20(10-14-22)28(4,5)6/h7-14H,15-18H2,1-6H3,(H4,29,31,33,35)(H4,30,32,34,36) |
| InChIKey | GKZFZZDAFYGRQR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.71 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|