C10H17N3O5S — CID 72716226
2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid (PubChem CID 72716226) has the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid.
| Compound Name | 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid |
|---|---|
| PubChem CID | 72716226 |
| Molecular Formula | C10H17N3O5S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid |
| SMILES | COc1ccc(OC)c(N=C(N)N)c1.CS(=O)(=O)O |
| InChI | InChI=1S/C9H13N3O2.CH4O3S/c1-13-6-3-4-8(14-2)7(5-6)12-9(10)11;1-5(2,3)4/h3-5H,1-2H3,(H4,10,11,12);1H3,(H,2,3,4) |
| InChIKey | ZPYXSCRHPPOGBK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|