2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid

C10H17N3O5S — CID 72716226

IUPAC2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid
SMILESCOc1ccc(OC)c(N=C(N)N)c1.CS(=O)(=O)O
InChIInChI=1S/C9H13N3O2.CH4O3S/c1-13-6-3-4-8(14-2)7(5-6)12-9(10)11;1-5(2,3)4/h3-5H,1-2H3,(H4,10,11,12);1H3,(H,2,3,4)
InChIKeyZPYXSCRHPPOGBK-UHFFFAOYSA-N
MW291.33 g/mol
LogP0.11
Rot. Bonds3

About 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid

2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid (PubChem CID 72716226) has the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid.

Molecular Properties

Compound Name2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid
PubChem CID72716226
Molecular FormulaC10H17N3O5S
Molecular Weight291.33 g/mol
Exact Mass291.09
IUPAC Name2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid
SMILESCOc1ccc(OC)c(N=C(N)N)c1.CS(=O)(=O)O
InChIInChI=1S/C9H13N3O2.CH4O3S/c1-13-6-3-4-8(14-2)7(5-6)12-9(10)11;1-5(2,3)4/h3-5H,1-2H3,(H4,10,11,12);1H3,(H,2,3,4)
InChIKeyZPYXSCRHPPOGBK-UHFFFAOYSA-N
XLogP0.11
TPSA137.23 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.33
LogP ≤ 50.11
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid?
The IUPAC name of 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid (CID 72716226) is 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid.
What is the SMILES notation for 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid?
The canonical SMILES for 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid is COc1ccc(OC)c(N=C(N)N)c1.CS(=O)(=O)O.
What is the InChIKey of 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid?
The InChIKey is ZPYXSCRHPPOGBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2.CH4O3S/c1-13-6-3-4-8(14-2)7(5-6)12-9(10)11;1-5(2,3)4/h3-5H,1-2H3,(H4,10,11,12);1H3,(H,2,3,4).
What are the key properties of 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid?
2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid has a molecular weight of 291.33 g/mol, XLogP of 0.11, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethoxyphenyl)guanidine;methanesulfonic acid is sourced from PubChem (CID 72716226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).