C23H31N5O3 — CID 169248204
1-(4-tert-butylphenyl)-3-[2-(2,5-dimethoxyphenyl)iminopropanehydrazonoyl]-1-methylurea (PubChem CID 169248204) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[2-(2,5-dimethoxyphenyl)iminopropanehydrazonoyl]-1-methylurea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[2-(2,5-dimethoxyphenyl)iminopropanehydrazonoyl]-1-methylurea |
|---|---|
| PubChem CID | 169248204 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[2-(2,5-dimethoxyphenyl)iminopropanehydrazonoyl]-1-methylurea |
| SMILES | COc1ccc(OC)c(/N=C(C)/C(=N\N)NC(=O)N(C)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C23H31N5O3/c1-15(25-19-14-18(30-6)12-13-20(19)31-7)21(27-24)26-22(29)28(5)17-10-8-16(9-11-17)23(2,3)4/h8-14H,24H2,1-7H3,(H,26,27,29)/b25-15+ |
| InChIKey | RZSYWLGBGKNFCK-MFKUBSTISA-N |
| XLogP | 4.21 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|