C30H43BrN4O4 — CID 169248048
(2E)-N-[3-(8-bromooctoxy)-5-tert-butylphenyl]-3-(2,5-dimethoxyphenyl)imino-2-hydrazinylidenebutanamide (PubChem CID 169248048) has the molecular formula C30H43BrN4O4 and a molecular weight of 603.60 g/mol. Its IUPAC name is (2E)-N-[3-(8-bromooctoxy)-5-tert-butylphenyl]-3-(2,5-dimethoxyphenyl)imino-2-hydrazinylidenebutanamide.
| Compound Name | (2E)-N-[3-(8-bromooctoxy)-5-tert-butylphenyl]-3-(2,5-dimethoxyphenyl)imino-2-hydrazinylidenebutanamide |
|---|---|
| PubChem CID | 169248048 |
| Molecular Formula | C30H43BrN4O4 |
| Molecular Weight | 603.60 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | (2E)-N-[3-(8-bromooctoxy)-5-tert-butylphenyl]-3-(2,5-dimethoxyphenyl)imino-2-hydrazinylidenebutanamide |
| SMILES | COc1ccc(OC)c(/N=C(C)/C(=N\N)C(=O)Nc2cc(OCCCCCCCCBr)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C30H43BrN4O4/c1-21(33-26-20-24(37-5)13-14-27(26)38-6)28(35-32)29(36)34-23-17-22(30(2,3)4)18-25(19-23)39-16-12-10-8-7-9-11-15-31/h13-14,17-20H,7-12,15-16,32H2,1-6H3,(H,34,36)/b33-21+,35-28+ |
| InChIKey | GWGNSJOPQUBQBI-MNIBPEFSSA-N |
| XLogP | 7.16 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.60 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|