C24H30N4O6 — CID 169248250
2-[3-tert-butyl-5-[[(2E)-3-(2,5-dimethoxyphenyl)imino-2-hydrazinylidenebutanoyl]amino]phenoxy]acetic acid (PubChem CID 169248250) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-[[(2E)-3-(2,5-dimethoxyphenyl)imino-2-hydrazinylidenebutanoyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[3-tert-butyl-5-[[(2E)-3-(2,5-dimethoxyphenyl)imino-2-hydrazinylidenebutanoyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 169248250 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-[3-tert-butyl-5-[[(2E)-3-(2,5-dimethoxyphenyl)imino-2-hydrazinylidenebutanoyl]amino]phenoxy]acetic acid |
| SMILES | COc1ccc(OC)c(/N=C(C)/C(=N\N)C(=O)Nc2cc(OCC(=O)O)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C24H30N4O6/c1-14(26-19-12-17(32-5)7-8-20(19)33-6)22(28-25)23(31)27-16-9-15(24(2,3)4)10-18(11-16)34-13-21(29)30/h7-12H,13,25H2,1-6H3,(H,27,31)(H,29,30)/b26-14+,28-22+ |
| InChIKey | NQRJDERHVUXCCW-ZESALXLYSA-N |
| XLogP | 3.51 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|