C9H13N3O5S — CID 140662030
[(2,4-dimethoxyphenyl)sulfonylamino]urea (PubChem CID 140662030) has the molecular formula C9H13N3O5S and a molecular weight of 275.29 g/mol. Its IUPAC name is [(2,4-dimethoxyphenyl)sulfonylamino]urea.
| Compound Name | [(2,4-dimethoxyphenyl)sulfonylamino]urea |
|---|---|
| PubChem CID | 140662030 |
| Molecular Formula | C9H13N3O5S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | [(2,4-dimethoxyphenyl)sulfonylamino]urea |
| SMILES | COc1ccc(S(=O)(=O)NNC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C9H13N3O5S/c1-16-6-3-4-8(7(5-6)17-2)18(14,15)12-11-9(10)13/h3-5,12H,1-2H3,(H3,10,11,13) |
| InChIKey | WKBKAZONXNSPIE-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|